C19H27NO11S — CID 583244
methyl 3-acetyl-2-(1,2,3,4-tetraacetyloxybutyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 583244) has the molecular formula C19H27NO11S and a molecular weight of 477.49 g/mol. Its IUPAC name is methyl 3-acetyl-2-(1,2,3,4-tetraacetyloxybutyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 3-acetyl-2-(1,2,3,4-tetraacetyloxybutyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 583244 |
| Molecular Formula | C19H27NO11S |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | methyl 3-acetyl-2-(1,2,3,4-tetraacetyloxybutyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1CSC(C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O)N1C(C)=O |
| InChI | InChI=1S/C19H27NO11S/c1-9(21)20-14(19(26)27-6)8-32-18(20)17(31-13(5)25)16(30-12(4)24)15(29-11(3)23)7-28-10(2)22/h14-18H,7-8H2,1-6H3 |
| InChIKey | WXEUINBQJQHTDK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|