C22H26N6 — CID 58325034
4-[[(3R,5S)-4-amino-1-adamantyl]methylamino]-2-anilinopyrimidine-5-carbonitrile (PubChem CID 58325034) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-[[(3R,5S)-4-amino-1-adamantyl]methylamino]-2-anilinopyrimidine-5-carbonitrile.
| Compound Name | 4-[[(3R,5S)-4-amino-1-adamantyl]methylamino]-2-anilinopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 58325034 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 4-[[(3R,5S)-4-amino-1-adamantyl]methylamino]-2-anilinopyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(Nc2ccccc2)nc1NCC12CC3C[C@H](C1)C(N)[C@@H](C3)C2 |
| InChI | InChI=1S/C22H26N6/c23-11-17-12-25-21(27-18-4-2-1-3-5-18)28-20(17)26-13-22-8-14-6-15(9-22)19(24)16(7-14)10-22/h1-5,12,14-16,19H,6-10,13,24H2,(H2,25,26,27,28)/t14?,15-,16+,19?,22? |
| InChIKey | WANZFSILBGGFDI-YMSKBKNJSA-N |
| XLogP | 3.66 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |