C28H33F3N6O2 — CID 58325150
tert-butyl N-[(1R,3S)-5-[[[5-cyano-2-[(2,3,5-trifluorophenyl)methylamino]pyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate (PubChem CID 58325150) has the molecular formula C28H33F3N6O2 and a molecular weight of 542.61 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-5-[[[5-cyano-2-[(2,3,5-trifluorophenyl)methylamino]pyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-5-[[[5-cyano-2-[(2,3,5-trifluorophenyl)methylamino]pyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate |
|---|---|
| PubChem CID | 58325150 |
| Molecular Formula | C28H33F3N6O2 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | tert-butyl N-[(1R,3S)-5-[[[5-cyano-2-[(2,3,5-trifluorophenyl)methylamino]pyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1[C@@H]2CC3C[C@H]1CC(CNc1nc(NCc4cc(F)cc(F)c4F)ncc1C#N)(C3)C2 |
| InChI | InChI=1S/C28H33F3N6O2/c1-27(2,3)39-26(38)36-23-16-4-15-5-17(23)10-28(8-15,9-16)14-35-24-19(11-32)13-34-25(37-24)33-12-18-6-20(29)7-21(30)22(18)31/h6-7,13,15-17,23H,4-5,8-10,12,14H2,1-3H3,(H,36,38)(H2,33,34,35,37)/t15?,16-,17+,23?,28? |
| InChIKey | SXJMOFHZGIFXFS-RKRTZCNPSA-N |
| XLogP | 5.51 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|