C27H35ClN6O4 — CID 58325203
tert-butyl N-[(1R,3S)-5-[[[2-[(2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate (PubChem CID 58325203) has the molecular formula C27H35ClN6O4 and a molecular weight of 543.07 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-5-[[[2-[(2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-5-[[[2-[(2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate |
|---|---|
| PubChem CID | 58325203 |
| Molecular Formula | C27H35ClN6O4 |
| Molecular Weight | 543.07 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | tert-butyl N-[(1R,3S)-5-[[[2-[(2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]methyl]-2-adamantyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1[C@@H]2CC3C[C@H]1CC(CNc1nc(NCc4ccccc4Cl)ncc1[N+](=O)[O-])(C3)C2 |
| InChI | InChI=1S/C27H35ClN6O4/c1-26(2,3)38-25(35)32-22-18-8-16-9-19(22)12-27(10-16,11-18)15-31-23-21(34(36)37)14-30-24(33-23)29-13-17-6-4-5-7-20(17)28/h4-7,14,16,18-19,22H,8-13,15H2,1-3H3,(H,32,35)(H2,29,30,31,33)/t16?,18-,19+,22?,27? |
| InChIKey | NHOGKHBYOCVWJN-ZGLFVULVSA-N |
| XLogP | 5.78 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.07 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|