About (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol
(1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol (PubChem CID 58325699) has the molecular formula C12H14O3S
and a molecular weight of 238.31 g/mol. Its IUPAC name is (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol |
| PubChem CID | 58325699 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol |
| SMILES | C[C@H]1C=Cc2c(cccc2S(C)(=O)=O)[C@H]1O |
| InChI | InChI=1S/C12H14O3S/c1-8-6-7-9-10(12(8)13)4-3-5-11(9)16(2,14)15/h3-8,12-13H,1-2H3/t8-,12-/m0/s1 |
| InChIKey | OTNLXJSKMVUMML-UFBFGSQYSA-N |
| XLogP | 1.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol?
The IUPAC name of (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol (CID 58325699) is (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol.
What is the SMILES notation for (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol?
The canonical SMILES for (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol is C[C@H]1C=Cc2c(cccc2S(C)(=O)=O)[C@H]1O.
What is the InChIKey of (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol?
The InChIKey is OTNLXJSKMVUMML-UFBFGSQYSA-N. The full InChI is InChI=1S/C12H14O3S/c1-8-6-7-9-10(12(8)13)4-3-5-11(9)16(2,14)15/h3-8,12-13H,1-2H3/t8-,12-/m0/s1.
What are the key properties of (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol?
(1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol has a molecular weight of 238.31 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-2-methyl-5-methylsulfonyl-1,2-dihydronaphthalen-1-ol is sourced from PubChem (CID 58325699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).