About sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide
sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide (PubChem CID 58325814) has the molecular formula C17H23NNaO2-
and a molecular weight of 296.37 g/mol. Its IUPAC name is sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide.
Molecular Properties
| Compound Name | sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide |
| PubChem CID | 58325814 |
| Molecular Formula | C17H23NNaO2- |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide |
| SMILES | CC(=O)CC1C[C@H]2CC[C@@H](C1)N2Cc1cc[c-]cc1.[Na+].[OH-] |
| InChI | InChI=1S/C17H22NO.Na.H2O/c1-13(19)9-15-10-16-7-8-17(11-15)18(16)12-14-5-3-2-4-6-14;;/h3-6,15-17H,7-12H2,1H3;;1H2/q-1;+1;/p-1/t15?,16-,17+;; |
| InChIKey | SLBHKANEWIHUSU-STZJSGMSSA-M |
| XLogP | 0.04 |
| TPSA | 50.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide?
The IUPAC name of sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide (CID 58325814) is sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide.
What is the SMILES notation for sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide?
The canonical SMILES for sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide is CC(=O)CC1C[C@H]2CC[C@@H](C1)N2Cc1cc[c-]cc1.[Na+].[OH-].
What is the InChIKey of sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide?
The InChIKey is SLBHKANEWIHUSU-STZJSGMSSA-M. The full InChI is InChI=1S/C17H22NO.Na.H2O/c1-13(19)9-15-10-16-7-8-17(11-15)18(16)12-14-5-3-2-4-6-14;;/h3-6,15-17H,7-12H2,1H3;;1H2/q-1;+1;/p-1/t15?,16-,17+;;.
What are the key properties of sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide?
sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide has a molecular weight of 296.37 g/mol, XLogP of 0.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-[(1R,5S)-8-(phenylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]propan-2-one;hydroxide is sourced from PubChem (CID 58325814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).