C21H23N5O3S — CID 58325820
2-[2-[4-([1,3]thiazolo[4,5-c]pyridin-2-yloxy)phenoxy]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 58325820) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[2-[4-([1,3]thiazolo[4,5-c]pyridin-2-yloxy)phenoxy]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | 2-[2-[4-([1,3]thiazolo[4,5-c]pyridin-2-yloxy)phenoxy]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 58325820 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[2-[4-([1,3]thiazolo[4,5-c]pyridin-2-yloxy)phenoxy]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | NC(=O)N1CC2CN(CCOc3ccc(Oc4nc5cnccc5s4)cc3)CC2C1 |
| InChI | InChI=1S/C21H23N5O3S/c22-20(27)26-12-14-10-25(11-15(14)13-26)7-8-28-16-1-3-17(4-2-16)29-21-24-18-9-23-6-5-19(18)30-21/h1-6,9,14-15H,7-8,10-13H2,(H2,22,27) |
| InChIKey | PXWPPTCOORTKRG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |