C36H54N2O6+2 — CID 58325871
3-[5-[2-[2,5-bis(2-methoxyethoxy)-4-prop-1-ynylphenyl]ethynyl]-4-[4-(dimethylazaniumyl)butoxy]-2-methylphenoxy]propyl-trimethylazanium (PubChem CID 58325871) has the molecular formula C36H54N2O6+2 and a molecular weight of 610.84 g/mol. Its IUPAC name is 3-[5-[2-[2,5-bis(2-methoxyethoxy)-4-prop-1-ynylphenyl]ethynyl]-4-[4-(dimethylazaniumyl)butoxy]-2-methylphenoxy]propyl-trimethylazanium.
| Compound Name | 3-[5-[2-[2,5-bis(2-methoxyethoxy)-4-prop-1-ynylphenyl]ethynyl]-4-[4-(dimethylazaniumyl)butoxy]-2-methylphenoxy]propyl-trimethylazanium |
|---|---|
| PubChem CID | 58325871 |
| Molecular Formula | C36H54N2O6+2 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.40 |
| IUPAC Name | 3-[5-[2-[2,5-bis(2-methoxyethoxy)-4-prop-1-ynylphenyl]ethynyl]-4-[4-(dimethylazaniumyl)butoxy]-2-methylphenoxy]propyl-trimethylazanium |
| SMILES | CC#Cc1cc(OCCOC)c(C#Cc2cc(OCCC[N+](C)(C)C)c(C)cc2OCCCC[NH+](C)C)cc1OCCOC |
| InChI | InChI=1S/C36H53N2O6/c1-10-14-30-27-36(44-24-22-40-9)32(28-35(30)43-23-21-39-8)16-15-31-26-33(41-20-13-18-38(5,6)7)29(2)25-34(31)42-19-12-11-17-37(3)4/h25-28H,11-13,17-24H2,1-9H3/q+1/p+1 |
| InChIKey | DJWMKZPSNMEDJS-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 59.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|