About 4-imidazol-1-yl-2,2-dimethylhexan-3-ol
4-imidazol-1-yl-2,2-dimethylhexan-3-ol (PubChem CID 58325903) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-imidazol-1-yl-2,2-dimethylhexan-3-ol.
Molecular Properties
| Compound Name | 4-imidazol-1-yl-2,2-dimethylhexan-3-ol |
| PubChem CID | 58325903 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 4-imidazol-1-yl-2,2-dimethylhexan-3-ol |
| SMILES | CCC(C(O)C(C)(C)C)n1ccnc1 |
| InChI | InChI=1S/C11H20N2O/c1-5-9(10(14)11(2,3)4)13-7-6-12-8-13/h6-10,14H,5H2,1-4H3 |
| InChIKey | XDNDQOFPESVGID-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-imidazol-1-yl-2,2-dimethylhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazol-1-yl-2,2-dimethylhexan-3-ol?
The IUPAC name of 4-imidazol-1-yl-2,2-dimethylhexan-3-ol (CID 58325903) is 4-imidazol-1-yl-2,2-dimethylhexan-3-ol.
What is the SMILES notation for 4-imidazol-1-yl-2,2-dimethylhexan-3-ol?
The canonical SMILES for 4-imidazol-1-yl-2,2-dimethylhexan-3-ol is CCC(C(O)C(C)(C)C)n1ccnc1.
What is the InChIKey of 4-imidazol-1-yl-2,2-dimethylhexan-3-ol?
The InChIKey is XDNDQOFPESVGID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-5-9(10(14)11(2,3)4)13-7-6-12-8-13/h6-10,14H,5H2,1-4H3.
What are the key properties of 4-imidazol-1-yl-2,2-dimethylhexan-3-ol?
4-imidazol-1-yl-2,2-dimethylhexan-3-ol has a molecular weight of 196.29 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazol-1-yl-2,2-dimethylhexan-3-ol is sourced from PubChem (CID 58325903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).