C32H55F3O2Si — CID 58326185
5-[(3R,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,1,1-trifluorohexan-2-one (PubChem CID 58326185) has the molecular formula C32H55F3O2Si and a molecular weight of 556.87 g/mol. Its IUPAC name is 5-[(3R,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,1,1-trifluorohexan-2-one.
| Compound Name | 5-[(3R,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,1,1-trifluorohexan-2-one |
|---|---|
| PubChem CID | 58326185 |
| Molecular Formula | C32H55F3O2Si |
| Molecular Weight | 556.87 g/mol |
| Exact Mass | 556.39 |
| IUPAC Name | 5-[(3R,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,1,1-trifluorohexan-2-one |
| SMILES | CC(CCC(=O)C(F)(F)F)C1CCC2C3C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]4C[C@H](C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C32H55F3O2Si/c1-20-14-16-31(7)25-15-17-30(6)23(21(2)10-13-28(36)32(33,34)35)11-12-24(30)22(25)19-27(26(31)18-20)37-38(8,9)29(3,4)5/h20-27H,10-19H2,1-9H3/t20-,21?,22?,23?,24?,25?,26+,27+,30?,31?/m1/s1 |
| InChIKey | ULUNAKKVMSHIGP-LXDPHJCUSA-N |
| XLogP | 9.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.87 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|