C28H39FN2O4 — CID 58326272
(6R)-N-(8-fluoro-1-hydroxy-5-oxooctan-2-yl)-N,9-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 58326272) has the molecular formula C28H39FN2O4 and a molecular weight of 486.63 g/mol. Its IUPAC name is (6R)-N-(8-fluoro-1-hydroxy-5-oxooctan-2-yl)-N,9-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | (6R)-N-(8-fluoro-1-hydroxy-5-oxooctan-2-yl)-N,9-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 58326272 |
| Molecular Formula | C28H39FN2O4 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | (6R)-N-(8-fluoro-1-hydroxy-5-oxooctan-2-yl)-N,9-dimethyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)c1c(n2C)CC[C@@H](C2CCOCC2)C1)C(CO)CCC(=O)CCCF |
| InChI | InChI=1S/C28H39FN2O4/c1-30(22(18-32)7-8-23(33)4-3-13-29)28(34)21-6-10-27-25(17-21)24-16-20(5-9-26(24)31(27)2)19-11-14-35-15-12-19/h6,10,17,19-20,22,32H,3-5,7-9,11-16,18H2,1-2H3/t20-,22?/m1/s1 |
| InChIKey | WCJOKCVDJGEXRC-PSDZMVHGSA-N |
| XLogP | 4.24 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|