About 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide
2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide (PubChem CID 58326774) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide |
| PubChem CID | 58326774 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide |
| SMILES | CC(C)C(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C7H12N4O/c1-5(2)7(12)8-3-6-9-4-10-11-6/h4-5H,3H2,1-2H3,(H,8,12)(H,9,10,11) |
| InChIKey | ASDPUNKMURRYGS-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide?
The IUPAC name of 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide (CID 58326774) is 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide.
What is the SMILES notation for 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide?
The canonical SMILES for 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide is CC(C)C(=O)NCc1ncn[nH]1.
What is the InChIKey of 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide?
The InChIKey is ASDPUNKMURRYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c1-5(2)7(12)8-3-6-9-4-10-11-6/h4-5H,3H2,1-2H3,(H,8,12)(H,9,10,11).
What are the key properties of 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide?
2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide has a molecular weight of 168.20 g/mol, XLogP of 0.08, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide is sourced from PubChem (CID 58326774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).