About N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine
N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine (PubChem CID 58328439) has the molecular formula C7H12N2S2
and a molecular weight of 188.32 g/mol. Its IUPAC name is N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine.
Molecular Properties
| Compound Name | N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine |
| PubChem CID | 58328439 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine |
| SMILES | CNCCSc1cnc(C)s1 |
| InChI | InChI=1S/C7H12N2S2/c1-6-9-5-7(11-6)10-4-3-8-2/h5,8H,3-4H2,1-2H3 |
| InChIKey | YHNJOIMCXASKBU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine?
The IUPAC name of N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine (CID 58328439) is N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine.
What is the SMILES notation for N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine?
The canonical SMILES for N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine is CNCCSc1cnc(C)s1.
What is the InChIKey of N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine?
The InChIKey is YHNJOIMCXASKBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2S2/c1-6-9-5-7(11-6)10-4-3-8-2/h5,8H,3-4H2,1-2H3.
What are the key properties of N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine?
N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine has a molecular weight of 188.32 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethanamine is sourced from PubChem (CID 58328439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).