C17H20F2O4S — CID 58328447
ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-(4-methylsulfonylphenyl)prop-2-enoate (PubChem CID 58328447) has the molecular formula C17H20F2O4S and a molecular weight of 358.41 g/mol. Its IUPAC name is ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-(4-methylsulfonylphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-(4-methylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58328447 |
| Molecular Formula | C17H20F2O4S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-(4-methylsulfonylphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/C1C[C@@H](F)[C@@H](F)C1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H20F2O4S/c1-3-23-17(20)14(8-11-9-15(18)16(19)10-11)12-4-6-13(7-5-12)24(2,21)22/h4-8,11,15-16H,3,9-10H2,1-2H3/b14-8+/t11?,15-,16+ |
| InChIKey | SWTYCSIBDULQKJ-RBOSQXIYSA-N |
| XLogP | 3.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|