C19H24F2O2S — CID 58328450
ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-(4-propylsulfanylphenyl)prop-2-enoate (PubChem CID 58328450) has the molecular formula C19H24F2O2S and a molecular weight of 354.46 g/mol. Its IUPAC name is ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-(4-propylsulfanylphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-(4-propylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58328450 |
| Molecular Formula | C19H24F2O2S |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-(4-propylsulfanylphenyl)prop-2-enoate |
| SMILES | CCCSc1ccc(/C(=C\C2C[C@@H](F)[C@@H](F)C2)C(=O)OCC)cc1 |
| InChI | InChI=1S/C19H24F2O2S/c1-3-9-24-15-7-5-14(6-8-15)16(19(22)23-4-2)10-13-11-17(20)18(21)12-13/h5-8,10,13,17-18H,3-4,9,11-12H2,1-2H3/b16-10+/t13?,17-,18+ |
| InChIKey | NUXPZFNCFXTVJA-CQJSWYMESA-N |
| XLogP | 5.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|