C19H24F2O4S — CID 58328485
ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-propylsulfonylphenyl)prop-2-enoate (PubChem CID 58328485) has the molecular formula C19H24F2O4S and a molecular weight of 386.46 g/mol. Its IUPAC name is ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-propylsulfonylphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-propylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58328485 |
| Molecular Formula | C19H24F2O4S |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-propylsulfonylphenyl)prop-2-enoate |
| SMILES | CCCS(=O)(=O)c1ccc(/C(=C\C2C[C@@H](F)[C@@H](F)C2)C(=O)OCC)cc1 |
| InChI | InChI=1S/C19H24F2O4S/c1-3-9-26(23,24)15-7-5-14(6-8-15)16(19(22)25-4-2)10-13-11-17(20)18(21)12-13/h5-8,10,13,17-18H,3-4,9,11-12H2,1-2H3/b16-10+/t13?,17-,18+ |
| InChIKey | JBORSMIEAMJWBL-CQJSWYMESA-N |
| XLogP | 3.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|