About N,N,2-trimethyl-1,3-thiazole-5-sulfonamide
N,N,2-trimethyl-1,3-thiazole-5-sulfonamide (PubChem CID 58328486) has the molecular formula C6H10N2O2S2
and a molecular weight of 206.29 g/mol. Its IUPAC name is N,N,2-trimethyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N,N,2-trimethyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 58328486 |
| Molecular Formula | C6H10N2O2S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | N,N,2-trimethyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)N(C)C)s1 |
| InChI | InChI=1S/C6H10N2O2S2/c1-5-7-4-6(11-5)12(9,10)8(2)3/h4H,1-3H3 |
| InChIKey | TXUDSQRMCJULHT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N,2-trimethyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-trimethyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of N,N,2-trimethyl-1,3-thiazole-5-sulfonamide (CID 58328486) is N,N,2-trimethyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N,N,2-trimethyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N,N,2-trimethyl-1,3-thiazole-5-sulfonamide is Cc1ncc(S(=O)(=O)N(C)C)s1.
What is the InChIKey of N,N,2-trimethyl-1,3-thiazole-5-sulfonamide?
The InChIKey is TXUDSQRMCJULHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2S2/c1-5-7-4-6(11-5)12(9,10)8(2)3/h4H,1-3H3.
What are the key properties of N,N,2-trimethyl-1,3-thiazole-5-sulfonamide?
N,N,2-trimethyl-1,3-thiazole-5-sulfonamide has a molecular weight of 206.29 g/mol, XLogP of 0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-trimethyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 58328486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).