C19H22F2O2S — CID 58328497
ethyl (E)-2-(4-cyclopropylsulfanylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]prop-2-enoate (PubChem CID 58328497) has the molecular formula C19H22F2O2S and a molecular weight of 352.45 g/mol. Its IUPAC name is ethyl (E)-2-(4-cyclopropylsulfanylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-(4-cyclopropylsulfanylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]prop-2-enoate |
|---|---|
| PubChem CID | 58328497 |
| Molecular Formula | C19H22F2O2S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | ethyl (E)-2-(4-cyclopropylsulfanylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/C1C[C@@H](F)[C@@H](F)C1)c1ccc(SC2CC2)cc1 |
| InChI | InChI=1S/C19H22F2O2S/c1-2-23-19(22)16(9-12-10-17(20)18(21)11-12)13-3-5-14(6-4-13)24-15-7-8-15/h3-6,9,12,15,17-18H,2,7-8,10-11H2,1H3/b16-9+/t12?,17-,18+ |
| InChIKey | ZUAGSJVCNVYWMI-VZKPGDEHSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|