About [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol
[(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol (PubChem CID 58328500) has the molecular formula C11H18N2OS2
and a molecular weight of 258.41 g/mol. Its IUPAC name is [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol |
| PubChem CID | 58328500 |
| Molecular Formula | C11H18N2OS2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol |
| SMILES | Cc1ncc(SCCN2CCC[C@H]2CO)s1 |
| InChI | InChI=1S/C11H18N2OS2/c1-9-12-7-11(16-9)15-6-5-13-4-2-3-10(13)8-14/h7,10,14H,2-6,8H2,1H3/t10-/m0/s1 |
| InChIKey | UFAJUAFODGQHDJ-JTQLQIEISA-N |
| XLogP | 2.00 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol?
The IUPAC name of [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol (CID 58328500) is [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol is Cc1ncc(SCCN2CCC[C@H]2CO)s1.
What is the InChIKey of [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol?
The InChIKey is UFAJUAFODGQHDJ-JTQLQIEISA-N. The full InChI is InChI=1S/C11H18N2OS2/c1-9-12-7-11(16-9)15-6-5-13-4-2-3-10(13)8-14/h7,10,14H,2-6,8H2,1H3/t10-/m0/s1.
What are the key properties of [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol?
[(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol has a molecular weight of 258.41 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-[2-[(2-methyl-1,3-thiazol-5-yl)sulfanyl]ethyl]pyrrolidin-2-yl]methanol is sourced from PubChem (CID 58328500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).