About 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol
2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol (PubChem CID 58328504) has the molecular formula C7H11NO2S
and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol |
| PubChem CID | 58328504 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol |
| SMILES | Cc1nc(C(CO)CO)cs1 |
| InChI | InChI=1S/C7H11NO2S/c1-5-8-7(4-11-5)6(2-9)3-10/h4,6,9-10H,2-3H2,1H3 |
| InChIKey | AFTCRKFWXGHAQO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol?
The IUPAC name of 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol (CID 58328504) is 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol.
What is the SMILES notation for 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol?
The canonical SMILES for 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol is Cc1nc(C(CO)CO)cs1.
What is the InChIKey of 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol?
The InChIKey is AFTCRKFWXGHAQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2S/c1-5-8-7(4-11-5)6(2-9)3-10/h4,6,9-10H,2-3H2,1H3.
What are the key properties of 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol?
2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol has a molecular weight of 173.24 g/mol, XLogP of 0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-thiazol-4-yl)propane-1,3-diol is sourced from PubChem (CID 58328504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).