C17H20F2O2S — CID 58328507
ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 58328507) has the molecular formula C17H20F2O2S and a molecular weight of 326.41 g/mol. Its IUPAC name is ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58328507 |
| Molecular Formula | C17H20F2O2S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/C1C[C@@H](F)[C@@H](F)C1)c1ccc(SC)cc1 |
| InChI | InChI=1S/C17H20F2O2S/c1-3-21-17(20)14(8-11-9-15(18)16(19)10-11)12-4-6-13(22-2)7-5-12/h4-8,11,15-16H,3,9-10H2,1-2H3/b14-8+/t11?,15-,16+ |
| InChIKey | PQJTYNZYUIQRSK-RBOSQXIYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|