C18H22F2O2S — CID 58328529
ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfanylphenyl)prop-2-enoate (PubChem CID 58328529) has the molecular formula C18H22F2O2S and a molecular weight of 340.44 g/mol. Its IUPAC name is ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfanylphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58328529 |
| Molecular Formula | C18H22F2O2S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | ethyl (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfanylphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/C1C[C@@H](F)[C@@H](F)C1)c1ccc(SCC)cc1 |
| InChI | InChI=1S/C18H22F2O2S/c1-3-22-18(21)15(9-12-10-16(19)17(20)11-12)13-5-7-14(8-6-13)23-4-2/h5-9,12,16-17H,3-4,10-11H2,1-2H3/b15-9+/t12?,16-,17+ |
| InChIKey | XIYCNYAQJNLDSW-ILLDFLLHSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|