C13H21N7 — CID 58328571
3-N-methyl-8-N-(3-pyrrolidin-1-ylpropyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-diamine (PubChem CID 58328571) has the molecular formula C13H21N7 and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-N-methyl-8-N-(3-pyrrolidin-1-ylpropyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-diamine.
| Compound Name | 3-N-methyl-8-N-(3-pyrrolidin-1-ylpropyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-diamine |
|---|---|
| PubChem CID | 58328571 |
| Molecular Formula | C13H21N7 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-N-methyl-8-N-(3-pyrrolidin-1-ylpropyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-diamine |
| SMILES | CNc1nnc2c(NCCCN3CCCC3)nccn12 |
| InChI | InChI=1S/C13H21N7/c1-14-13-18-17-12-11(16-6-10-20(12)13)15-5-4-9-19-7-2-3-8-19/h6,10H,2-5,7-9H2,1H3,(H,14,18)(H,15,16) |
| InChIKey | LCHLSPZTUDFNJE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|