C14H23N7 — CID 58328667
3-N-methyl-8-N-(3-piperidin-1-ylpropyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-diamine (PubChem CID 58328667) has the molecular formula C14H23N7 and a molecular weight of 289.39 g/mol. Its IUPAC name is 3-N-methyl-8-N-(3-piperidin-1-ylpropyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-diamine.
| Compound Name | 3-N-methyl-8-N-(3-piperidin-1-ylpropyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-diamine |
|---|---|
| PubChem CID | 58328667 |
| Molecular Formula | C14H23N7 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-N-methyl-8-N-(3-piperidin-1-ylpropyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-diamine |
| SMILES | CNc1nnc2c(NCCCN3CCCCC3)nccn12 |
| InChI | InChI=1S/C14H23N7/c1-15-14-19-18-13-12(17-7-11-21(13)14)16-6-5-10-20-8-3-2-4-9-20/h7,11H,2-6,8-10H2,1H3,(H,15,19)(H,16,17) |
| InChIKey | FNKDGGXIDGDPQO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|