C24H29ClN2O2 — CID 58329036
(2S)-1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[(7-methylidene-6,8-dihydro-5H-naphthalen-2-yl)oxy]propan-2-ol (PubChem CID 58329036) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is (2S)-1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[(7-methylidene-6,8-dihydro-5H-naphthalen-2-yl)oxy]propan-2-ol.
| Compound Name | (2S)-1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[(7-methylidene-6,8-dihydro-5H-naphthalen-2-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 58329036 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2S)-1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[(7-methylidene-6,8-dihydro-5H-naphthalen-2-yl)oxy]propan-2-ol |
| SMILES | C=C1CCc2ccc(OC[C@@H](O)CN3CCN(c4ccc(Cl)cc4)CC3)cc2C1 |
| InChI | InChI=1S/C24H29ClN2O2/c1-18-2-3-19-4-9-24(15-20(19)14-18)29-17-23(28)16-26-10-12-27(13-11-26)22-7-5-21(25)6-8-22/h4-9,15,23,28H,1-3,10-14,16-17H2/t23-/m0/s1 |
| InChIKey | HJUFNWMIOSNDPB-QHCPKHFHSA-N |
| XLogP | 3.95 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|