C25H23N3O5 — CID 58329469
1-cyclopentyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-methoxypyrimido[5,4-c]quinoline-2,4-dione (PubChem CID 58329469) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-methoxypyrimido[5,4-c]quinoline-2,4-dione.
| Compound Name | 1-cyclopentyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-methoxypyrimido[5,4-c]quinoline-2,4-dione |
|---|---|
| PubChem CID | 58329469 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-cyclopentyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-methoxypyrimido[5,4-c]quinoline-2,4-dione |
| SMILES | COc1cccc2c1ncc1c(=O)n(-c3ccc4c(c3)OCCO4)c(=O)n(C3CCCC3)c12 |
| InChI | InChI=1S/C25H23N3O5/c1-31-20-8-4-7-17-22(20)26-14-18-23(17)27(15-5-2-3-6-15)25(30)28(24(18)29)16-9-10-19-21(13-16)33-12-11-32-19/h4,7-10,13-15H,2-3,5-6,11-12H2,1H3 |
| InChIKey | FUOSKBKPXMUPKQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|