C23H19F6NO3 — CID 58329579
2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6,7,8,9-tetrahydropyrido[1,2-a]indol-9-yl]acetic acid (PubChem CID 58329579) has the molecular formula C23H19F6NO3 and a molecular weight of 471.40 g/mol. Its IUPAC name is 2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6,7,8,9-tetrahydropyrido[1,2-a]indol-9-yl]acetic acid.
| Compound Name | 2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6,7,8,9-tetrahydropyrido[1,2-a]indol-9-yl]acetic acid |
|---|---|
| PubChem CID | 58329579 |
| Molecular Formula | C23H19F6NO3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6,7,8,9-tetrahydropyrido[1,2-a]indol-9-yl]acetic acid |
| SMILES | O=C(O)CC1CCCn2c1cc1cc(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc12 |
| InChI | InChI=1S/C23H19F6NO3/c24-22(25,26)16-6-13(7-17(11-16)23(27,28)29)12-33-18-3-4-19-15(8-18)9-20-14(10-21(31)32)2-1-5-30(19)20/h3-4,6-9,11,14H,1-2,5,10,12H2,(H,31,32) |
| InChIKey | XQMAHKURCKRHEI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |