About 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene
1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene (PubChem CID 58329702) has the molecular formula C13H17F3
and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene.
Molecular Properties
| Compound Name | 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene |
| PubChem CID | 58329702 |
| Molecular Formula | C13H17F3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene |
| SMILES | C#CC1=CCC(CCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17F3/c1-2-11-6-8-12(9-7-11)5-3-4-10-13(14,15)16/h1,6,12H,3-5,7-10H2 |
| InChIKey | SLHQMFQFQVTHFO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene?
The IUPAC name of 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene (CID 58329702) is 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene.
What is the SMILES notation for 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene?
The canonical SMILES for 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene is C#CC1=CCC(CCCCC(F)(F)F)CC1.
What is the InChIKey of 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene?
The InChIKey is SLHQMFQFQVTHFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3/c1-2-11-6-8-12(9-7-11)5-3-4-10-13(14,15)16/h1,6,12H,3-5,7-10H2.
What are the key properties of 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene?
1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene has a molecular weight of 230.27 g/mol, XLogP of 4.47, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-4-(5,5,5-trifluoropentyl)cyclohexene is sourced from PubChem (CID 58329702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).