About 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane
1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane (PubChem CID 58329705) has the molecular formula C16H25F3
and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane.
Molecular Properties
| Compound Name | 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane |
| PubChem CID | 58329705 |
| Molecular Formula | C16H25F3 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane |
| SMILES | CCCC#CC1CCC(CCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C16H25F3/c1-2-3-4-7-14-9-11-15(12-10-14)8-5-6-13-16(17,18)19/h14-15H,2-3,5-6,8-13H2,1H3 |
| InChIKey | VTSFJTCORDCCIU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane?
The IUPAC name of 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane (CID 58329705) is 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane.
What is the SMILES notation for 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane?
The canonical SMILES for 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane is CCCC#CC1CCC(CCCCC(F)(F)F)CC1.
What is the InChIKey of 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane?
The InChIKey is VTSFJTCORDCCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F3/c1-2-3-4-7-14-9-11-15(12-10-14)8-5-6-13-16(17,18)19/h14-15H,2-3,5-6,8-13H2,1H3.
What are the key properties of 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane?
1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane has a molecular weight of 274.37 g/mol, XLogP of 5.72, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pent-1-ynyl-4-(5,5,5-trifluoropentyl)cyclohexane is sourced from PubChem (CID 58329705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).