methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate

C13H20O5S — CID 58329709

IUPACmethyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate
SMILESCOC(=O)C(SC(C)=O)C1CCC2(CC1)OCCO2
InChIInChI=1S/C13H20O5S/c1-9(14)19-11(12(15)16-2)10-3-5-13(6-4-10)17-7-8-18-13/h10-11H,3-8H2,1-2H3
InChIKeyXRCWSFDYFYANCO-UHFFFAOYSA-N
MW288.36 g/mol
LogP1.74
Rot. Bonds3

About methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate

methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate (PubChem CID 58329709) has the molecular formula C13H20O5S and a molecular weight of 288.36 g/mol. Its IUPAC name is methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate.

Molecular Properties

Compound Namemethyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate
PubChem CID58329709
Molecular FormulaC13H20O5S
Molecular Weight288.36 g/mol
Exact Mass288.10
IUPAC Namemethyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate
SMILESCOC(=O)C(SC(C)=O)C1CCC2(CC1)OCCO2
InChIInChI=1S/C13H20O5S/c1-9(14)19-11(12(15)16-2)10-3-5-13(6-4-10)17-7-8-18-13/h10-11H,3-8H2,1-2H3
InChIKeyXRCWSFDYFYANCO-UHFFFAOYSA-N
XLogP1.74
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.36
LogP ≤ 51.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate?
The IUPAC name of methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate (CID 58329709) is methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate.
What is the SMILES notation for methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate?
The canonical SMILES for methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate is COC(=O)C(SC(C)=O)C1CCC2(CC1)OCCO2.
What is the InChIKey of methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate?
The InChIKey is XRCWSFDYFYANCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O5S/c1-9(14)19-11(12(15)16-2)10-3-5-13(6-4-10)17-7-8-18-13/h10-11H,3-8H2,1-2H3.
What are the key properties of methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate?
methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate has a molecular weight of 288.36 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetylsulfanyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetate is sourced from PubChem (CID 58329709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).