About 2-cyclopentyl-6,6,6-trifluorohexanenitrile
2-cyclopentyl-6,6,6-trifluorohexanenitrile (PubChem CID 58329728) has the molecular formula C11H16F3N
and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-cyclopentyl-6,6,6-trifluorohexanenitrile.
Molecular Properties
| Compound Name | 2-cyclopentyl-6,6,6-trifluorohexanenitrile |
| PubChem CID | 58329728 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-cyclopentyl-6,6,6-trifluorohexanenitrile |
| SMILES | N#CC(CCCC(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C11H16F3N/c12-11(13,14)7-3-6-10(8-15)9-4-1-2-5-9/h9-10H,1-7H2 |
| InChIKey | LHUHTKFBJHFKHS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopentyl-6,6,6-trifluorohexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-6,6,6-trifluorohexanenitrile?
The IUPAC name of 2-cyclopentyl-6,6,6-trifluorohexanenitrile (CID 58329728) is 2-cyclopentyl-6,6,6-trifluorohexanenitrile.
What is the SMILES notation for 2-cyclopentyl-6,6,6-trifluorohexanenitrile?
The canonical SMILES for 2-cyclopentyl-6,6,6-trifluorohexanenitrile is N#CC(CCCC(F)(F)F)C1CCCC1.
What is the InChIKey of 2-cyclopentyl-6,6,6-trifluorohexanenitrile?
The InChIKey is LHUHTKFBJHFKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N/c12-11(13,14)7-3-6-10(8-15)9-4-1-2-5-9/h9-10H,1-7H2.
What are the key properties of 2-cyclopentyl-6,6,6-trifluorohexanenitrile?
2-cyclopentyl-6,6,6-trifluorohexanenitrile has a molecular weight of 219.25 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-6,6,6-trifluorohexanenitrile is sourced from PubChem (CID 58329728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).