About 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile
2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile (PubChem CID 58329751) has the molecular formula C13H18ClF3N2
and a molecular weight of 294.75 g/mol. Its IUPAC name is 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile.
Molecular Properties
| Compound Name | 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile |
| PubChem CID | 58329751 |
| Molecular Formula | C13H18ClF3N2 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile |
| SMILES | CN=C1CCC(C(Cl)(C#N)CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H18ClF3N2/c1-19-11-5-3-10(4-6-11)12(14,9-18)7-2-8-13(15,16)17/h10H,2-8H2,1H3/b19-11- |
| InChIKey | SIZYJWLSOAQHNS-ODLFYWEKSA-N |
| XLogP | 4.48 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile?
The IUPAC name of 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile (CID 58329751) is 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile.
What is the SMILES notation for 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile?
The canonical SMILES for 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile is CN=C1CCC(C(Cl)(C#N)CCCC(F)(F)F)CC1.
What is the InChIKey of 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile?
The InChIKey is SIZYJWLSOAQHNS-ODLFYWEKSA-N. The full InChI is InChI=1S/C13H18ClF3N2/c1-19-11-5-3-10(4-6-11)12(14,9-18)7-2-8-13(15,16)17/h10H,2-8H2,1H3/b19-11-.
What are the key properties of 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile?
2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile has a molecular weight of 294.75 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,6,6-trifluoro-2-(4-methyliminocyclohexyl)hexanenitrile is sourced from PubChem (CID 58329751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).