C31H49NO3Si — CID 58329997
tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethyloctan-2-yl]carbamate (PubChem CID 58329997) has the molecular formula C31H49NO3Si and a molecular weight of 511.82 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethyloctan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethyloctan-2-yl]carbamate |
|---|---|
| PubChem CID | 58329997 |
| Molecular Formula | C31H49NO3Si |
| Molecular Weight | 511.82 g/mol |
| Exact Mass | 511.35 |
| IUPAC Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethyloctan-2-yl]carbamate |
| SMILES | CCCC[C@@H](CC)C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H49NO3Si/c1-9-11-18-25(10-2)23-26(32-29(33)35-30(3,4)5)24-34-36(31(6,7)8,27-19-14-12-15-20-27)28-21-16-13-17-22-28/h12-17,19-22,25-26H,9-11,18,23-24H2,1-8H3,(H,32,33)/t25-,26+/m1/s1 |
| InChIKey | AXLLEZHCRCARCE-FTJBHMTQSA-N |
| XLogP | 7.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.82 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|