C29H43NO4Si — CID 58330028
tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-(hydroxymethyl)hept-6-en-2-yl]carbamate (PubChem CID 58330028) has the molecular formula C29H43NO4Si and a molecular weight of 497.75 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-(hydroxymethyl)hept-6-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-(hydroxymethyl)hept-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58330028 |
| Molecular Formula | C29H43NO4Si |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-(hydroxymethyl)hept-6-en-2-yl]carbamate |
| SMILES | C=CC[C@@H](CO)C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H43NO4Si/c1-8-15-23(21-31)20-24(30-27(32)34-28(2,3)4)22-33-35(29(5,6)7,25-16-11-9-12-17-25)26-18-13-10-14-19-26/h8-14,16-19,23-24,31H,1,15,20-22H2,2-7H3,(H,30,32)/t23-,24+/m1/s1 |
| InChIKey | RDNCHGOIVUFZGK-RPWUZVMVSA-N |
| XLogP | 5.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|