C30H45NO3Si — CID 58330043
tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethylhept-6-en-2-yl]carbamate (PubChem CID 58330043) has the molecular formula C30H45NO3Si and a molecular weight of 495.78 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethylhept-6-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethylhept-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58330043 |
| Molecular Formula | C30H45NO3Si |
| Molecular Weight | 495.78 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethylhept-6-en-2-yl]carbamate |
| SMILES | C=CC[C@@H](CC)C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H45NO3Si/c1-9-17-24(10-2)22-25(31-28(32)34-29(3,4)5)23-33-35(30(6,7)8,26-18-13-11-14-19-26)27-20-15-12-16-21-27/h9,11-16,18-21,24-25H,1,10,17,22-23H2,2-8H3,(H,31,32)/t24-,25+/m1/s1 |
| InChIKey | ITHAKJDVMRZFNL-RPBOFIJWSA-N |
| XLogP | 6.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|