C16H24O4 — CID 58330120
methyl (4'aR,8'aS)-2',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-carboxylate (PubChem CID 58330120) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (4'aR,8'aS)-2',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-carboxylate.
| Compound Name | methyl (4'aR,8'aS)-2',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-carboxylate |
|---|---|
| PubChem CID | 58330120 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (4'aR,8'aS)-2',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-carboxylate |
| SMILES | COC(=O)C1=C(C)CC[C@]2(C)[C@@H]1CCCC21OCCO1 |
| InChI | InChI=1S/C16H24O4/c1-11-6-8-15(2)12(13(11)14(17)18-3)5-4-7-16(15)19-9-10-20-16/h12H,4-10H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | WKRLLJNBHRZNIS-IUODEOHRSA-N |
| XLogP | 2.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |