C20H30O — CID 58330134
(1R,4aR,8R,8aS,10aS)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde (PubChem CID 58330134) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (1R,4aR,8R,8aS,10aS)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde.
| Compound Name | (1R,4aR,8R,8aS,10aS)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde |
|---|---|
| PubChem CID | 58330134 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (1R,4aR,8R,8aS,10aS)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde |
| SMILES | C=C[C@@]1(C)CCC=C2[C@H]1CC[C@H]1[C@@]2(C)CCC[C@@]1(C)C=O |
| InChI | InChI=1S/C20H30O/c1-5-18(2)11-6-8-16-15(18)9-10-17-19(3,14-21)12-7-13-20(16,17)4/h5,8,14-15,17H,1,6-7,9-13H2,2-4H3/t15-,17-,18+,19+,20+/m1/s1 |
| InChIKey | FRWGFZCEJHOMAD-LGKHCZOZSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|