C26H42N2O — CID 58330146
1-[(1S,4aR,8R,8aS,10aR)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-3-piperazin-1-ylpropan-2-one (PubChem CID 58330146) has the molecular formula C26H42N2O and a molecular weight of 398.64 g/mol. Its IUPAC name is 1-[(1S,4aR,8R,8aS,10aR)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-3-piperazin-1-ylpropan-2-one.
| Compound Name | 1-[(1S,4aR,8R,8aS,10aR)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-3-piperazin-1-ylpropan-2-one |
|---|---|
| PubChem CID | 58330146 |
| Molecular Formula | C26H42N2O |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | 1-[(1S,4aR,8R,8aS,10aR)-8-ethenyl-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-3-piperazin-1-ylpropan-2-one |
| SMILES | C=C[C@@]1(C)CCC=C2[C@H]1CC[C@@H]1[C@](C)(CC(=O)CN3CCNCC3)CCC[C@@]21C |
| InChI | InChI=1S/C26H42N2O/c1-5-24(2)11-6-8-22-21(24)9-10-23-25(3,12-7-13-26(22,23)4)18-20(29)19-28-16-14-27-15-17-28/h5,8,21,23,27H,1,6-7,9-19H2,2-4H3/t21-,23-,24+,25+,26+/m1/s1 |
| InChIKey | WUDNYCICVZXIKG-MQNYBYKRSA-N |
| XLogP | 4.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|