C16H15F9OS2 — CID 58330184
6-methyl-8-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethyl)-4H-1,3-benzoxathiine (PubChem CID 58330184) has the molecular formula C16H15F9OS2 and a molecular weight of 458.41 g/mol. Its IUPAC name is 6-methyl-8-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethyl)-4H-1,3-benzoxathiine.
| Compound Name | 6-methyl-8-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethyl)-4H-1,3-benzoxathiine |
|---|---|
| PubChem CID | 58330184 |
| Molecular Formula | C16H15F9OS2 |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 6-methyl-8-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethyl)-4H-1,3-benzoxathiine |
| SMILES | Cc1cc(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2c(c1)CSCO2 |
| InChI | InChI=1S/C16H15F9OS2/c1-9-4-10(12-11(5-9)7-28-8-26-12)6-27-3-2-13(17,18)14(19,20)15(21,22)16(23,24)25/h4-5H,2-3,6-8H2,1H3 |
| InChIKey | DAMMRHZBIMIUDD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|