C29H49ClN2O3PRuSi+ — CID 58330314
chlororuthenium(1+);tricyclohexylphosphanium;trihydroxy-[4-[(3-methyl-2H-imidazol-2-id-1-yl)methyl]phenyl]silane (PubChem CID 58330314) has the molecular formula C29H49ClN2O3PRuSi+ and a molecular weight of 669.31 g/mol. Its IUPAC name is chlororuthenium(1+);tricyclohexylphosphanium;trihydroxy-[4-[(3-methyl-2H-imidazol-2-id-1-yl)methyl]phenyl]silane.
| Compound Name | chlororuthenium(1+);tricyclohexylphosphanium;trihydroxy-[4-[(3-methyl-2H-imidazol-2-id-1-yl)methyl]phenyl]silane |
|---|---|
| PubChem CID | 58330314 |
| Molecular Formula | C29H49ClN2O3PRuSi+ |
| Molecular Weight | 669.31 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | chlororuthenium(1+);tricyclohexylphosphanium;trihydroxy-[4-[(3-methyl-2H-imidazol-2-id-1-yl)methyl]phenyl]silane |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.CN1C=CN(Cc2ccc([Si](O)(O)O)cc2)[CH-]1.Cl[Ru+] |
| InChI | InChI=1S/C18H33P.C11H15N2O3Si.ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-12-6-7-13(9-12)8-10-2-4-11(5-3-10)17(14,15)16;;/h16-18H,1-15H2;2-7,9,14-16H,8H2,1H3;1H;/q;-1;;+2 |
| InChIKey | PMGQXOHUVZULRX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.31 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|