C6H4F6O5 — CID 58330334
2-[(2,2,4,5,5-pentafluoro-1,3-dioxolan-4-yl)oxy]ethyl carbonofluoridate (PubChem CID 58330334) has the molecular formula C6H4F6O5 and a molecular weight of 270.08 g/mol. Its IUPAC name is 2-[(2,2,4,5,5-pentafluoro-1,3-dioxolan-4-yl)oxy]ethyl carbonofluoridate.
| Compound Name | 2-[(2,2,4,5,5-pentafluoro-1,3-dioxolan-4-yl)oxy]ethyl carbonofluoridate |
|---|---|
| PubChem CID | 58330334 |
| Molecular Formula | C6H4F6O5 |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 2-[(2,2,4,5,5-pentafluoro-1,3-dioxolan-4-yl)oxy]ethyl carbonofluoridate |
| SMILES | O=C(F)OCCOC1(F)OC(F)(F)OC1(F)F |
| InChI | InChI=1S/C6H4F6O5/c7-3(13)14-1-2-15-5(10)4(8,9)16-6(11,12)17-5/h1-2H2 |
| InChIKey | VQWHLWBAUYDICG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|