C8H7F7O5 — CID 58330337
2-[[4,5,5-trifluoro-2-methyl-2-(trifluoromethyl)-1,3-dioxolan-4-yl]oxy]ethyl carbonofluoridate (PubChem CID 58330337) has the molecular formula C8H7F7O5 and a molecular weight of 316.13 g/mol. Its IUPAC name is 2-[[4,5,5-trifluoro-2-methyl-2-(trifluoromethyl)-1,3-dioxolan-4-yl]oxy]ethyl carbonofluoridate.
| Compound Name | 2-[[4,5,5-trifluoro-2-methyl-2-(trifluoromethyl)-1,3-dioxolan-4-yl]oxy]ethyl carbonofluoridate |
|---|---|
| PubChem CID | 58330337 |
| Molecular Formula | C8H7F7O5 |
| Molecular Weight | 316.13 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-[[4,5,5-trifluoro-2-methyl-2-(trifluoromethyl)-1,3-dioxolan-4-yl]oxy]ethyl carbonofluoridate |
| SMILES | CC1(C(F)(F)F)OC(F)(F)C(F)(OCCOC(=O)F)O1 |
| InChI | InChI=1S/C8H7F7O5/c1-5(6(10,11)12)19-7(13,14)8(15,20-5)18-3-2-17-4(9)16/h2-3H2,1H3 |
| InChIKey | ZQRWBEFUVZHMAQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|