C25H33F3N2O — CID 58330447
1-[3-phenyl-2-(4,4,4-trifluorobutyl)-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone (PubChem CID 58330447) has the molecular formula C25H33F3N2O and a molecular weight of 434.55 g/mol. Its IUPAC name is 1-[3-phenyl-2-(4,4,4-trifluorobutyl)-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone.
| Compound Name | 1-[3-phenyl-2-(4,4,4-trifluorobutyl)-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
|---|---|
| PubChem CID | 58330447 |
| Molecular Formula | C25H33F3N2O |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 1-[3-phenyl-2-(4,4,4-trifluorobutyl)-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](CC(=O)C1=NN(CCCC(F)(F)F)C(c3ccccc3)C1)C2 |
| InChI | InChI=1S/C25H33F3N2O/c1-23(2)18-10-12-24(23,3)19(14-18)15-22(31)20-16-21(17-8-5-4-6-9-17)30(29-20)13-7-11-25(26,27)28/h4-6,8-9,18-19,21H,7,10-16H2,1-3H3/t18-,19+,21?,24-/m0/s1 |
| InChIKey | ZGAUXAIBJWRMDM-BVQBTSEISA-N |
| XLogP | 6.55 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |