C25H33F3N2O — CID 58330449
1-[2-propyl-3-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone (PubChem CID 58330449) has the molecular formula C25H33F3N2O and a molecular weight of 434.55 g/mol. Its IUPAC name is 1-[2-propyl-3-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone.
| Compound Name | 1-[2-propyl-3-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
|---|---|
| PubChem CID | 58330449 |
| Molecular Formula | C25H33F3N2O |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 1-[2-propyl-3-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
| SMILES | CCCN1N=C(C(=O)C[C@H]2C[C@@H]3CC[C@]2(C)C3(C)C)CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H33F3N2O/c1-5-11-30-21(16-7-6-8-18(12-16)25(26,27)28)15-20(29-30)22(31)14-19-13-17-9-10-24(19,4)23(17,2)3/h6-8,12,17,19,21H,5,9-11,13-15H2,1-4H3/t17-,19+,21?,24-/m0/s1 |
| InChIKey | ZELYDFXIQUUTFX-RFJKXHRSSA-N |
| XLogP | 6.64 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |