C16H24F6O2 — CID 58330634
1,1,1-trifluoro-2-[5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propan-2-ol (PubChem CID 58330634) has the molecular formula C16H24F6O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 58330634 |
| Molecular Formula | C16H24F6O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1,1,1-trifluoro-2-[5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]propan-2-ol |
| SMILES | CC(O)(C1CCCC2C1CCCC2C(C)(O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H24F6O2/c1-13(23,15(17,18)19)11-7-3-6-10-9(11)5-4-8-12(10)14(2,24)16(20,21)22/h9-12,23-24H,3-8H2,1-2H3 |
| InChIKey | SFCLDYBBEWEQAC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |