C44H26F6N2O4 — CID 58330922
2,6-bis[(4-methylphenyl)methyl]-4,8-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 58330922) has the molecular formula C44H26F6N2O4 and a molecular weight of 760.69 g/mol. Its IUPAC name is 2,6-bis[(4-methylphenyl)methyl]-4,8-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[(4-methylphenyl)methyl]-4,8-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 58330922 |
| Molecular Formula | C44H26F6N2O4 |
| Molecular Weight | 760.69 g/mol |
| Exact Mass | 760.18 |
| IUPAC Name | 2,6-bis[(4-methylphenyl)methyl]-4,8-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(Cn2c(=O)c3c(C#Cc4ccc(C(F)(F)F)cc4)c4c(=O)n(Cc5ccc(C)cc5)c(=O)c4c(C#Cc4ccc(C(F)(F)F)cc4)c3c2=O)cc1 |
| InChI | InChI=1S/C44H26F6N2O4/c1-25-3-7-29(8-4-25)23-51-39(53)35-33(21-15-27-11-17-31(18-12-27)43(45,46)47)37-38(42(56)52(41(37)55)24-30-9-5-26(2)6-10-30)34(36(35)40(51)54)22-16-28-13-19-32(20-14-28)44(48,49)50/h3-14,17-20H,23-24H2,1-2H3 |
| InChIKey | AQINMGWIUKAPDB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.69 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|