C44H23F9N2O4 — CID 58330924
6-[(4-methylphenyl)methyl]-4,8-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]-2-[[4-(trifluoromethyl)phenyl]methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 58330924) has the molecular formula C44H23F9N2O4 and a molecular weight of 814.66 g/mol. Its IUPAC name is 6-[(4-methylphenyl)methyl]-4,8-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]-2-[[4-(trifluoromethyl)phenyl]methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-[(4-methylphenyl)methyl]-4,8-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]-2-[[4-(trifluoromethyl)phenyl]methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 58330924 |
| Molecular Formula | C44H23F9N2O4 |
| Molecular Weight | 814.66 g/mol |
| Exact Mass | 814.15 |
| IUPAC Name | 6-[(4-methylphenyl)methyl]-4,8-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]-2-[[4-(trifluoromethyl)phenyl]methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(Cn2c(=O)c3c(C#Cc4ccc(C(F)(F)F)cc4)c4c(=O)n(Cc5ccc(C(F)(F)F)cc5)c(=O)c4c(C#Cc4ccc(C(F)(F)F)cc4)c3c2=O)cc1 |
| InChI | InChI=1S/C44H23F9N2O4/c1-24-2-4-27(5-3-24)22-54-38(56)34-32(20-12-25-6-14-29(15-7-25)42(45,46)47)36-37(41(59)55(40(36)58)23-28-10-18-31(19-11-28)44(51,52)53)33(35(34)39(54)57)21-13-26-8-16-30(17-9-26)43(48,49)50/h2-11,14-19H,22-23H2,1H3 |
| InChIKey | RUWZPHNAWGISJD-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.66 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|