About 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium
1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium (PubChem CID 58330977) has the molecular formula C20H22FIrN2O4-
and a molecular weight of 565.62 g/mol. Its IUPAC name is 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium.
Molecular Properties
| Compound Name | 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium |
| PubChem CID | 58330977 |
| Molecular Formula | C20H22FIrN2O4- |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium |
| SMILES | COC(O)CC(O)OC.Cc1nc2ccccc2nc1-c1[c-]cc(F)cc1.[Ir] |
| InChI | InChI=1S/C15H10FN2.C5H12O4.Ir/c1-10-15(11-6-8-12(16)9-7-11)18-14-5-3-2-4-13(14)17-10;1-8-4(6)3-5(7)9-2;/h2-6,8-9H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | LFZGNKVXKBYGQA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium?
The IUPAC name of 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium (CID 58330977) is 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium.
What is the SMILES notation for 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium?
The canonical SMILES for 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium is COC(O)CC(O)OC.Cc1nc2ccccc2nc1-c1[c-]cc(F)cc1.[Ir].
What is the InChIKey of 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium?
The InChIKey is LFZGNKVXKBYGQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FN2.C5H12O4.Ir/c1-10-15(11-6-8-12(16)9-7-11)18-14-5-3-2-4-13(14)17-10;1-8-4(6)3-5(7)9-2;/h2-6,8-9H,1H3;4-7H,3H2,1-2H3;/q-1;;.
What are the key properties of 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium?
1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium has a molecular weight of 565.62 g/mol, XLogP of 2.85, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethoxypropane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium is sourced from PubChem (CID 58330977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).