About 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol
2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol (PubChem CID 58330980) has the molecular formula C20H22ClIrN2O2-
and a molecular weight of 550.08 g/mol. Its IUPAC name is 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol.
Molecular Properties
| Compound Name | 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol |
| PubChem CID | 58330980 |
| Molecular Formula | C20H22ClIrN2O2- |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.Cc1nc2ccccc2nc1-c1[c-]cc(Cl)cc1.[Ir] |
| InChI | InChI=1S/C15H10ClN2.C5H12O2.Ir/c1-10-15(11-6-8-12(16)9-7-11)18-14-5-3-2-4-13(14)17-10;1-4(6)3-5(2)7;/h2-6,8-9H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | VQWNQYQLCMVPAH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol?
The IUPAC name of 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol (CID 58330980) is 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol.
What is the SMILES notation for 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol?
The canonical SMILES for 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol is CC(O)CC(C)O.Cc1nc2ccccc2nc1-c1[c-]cc(Cl)cc1.[Ir].
What is the InChIKey of 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol?
The InChIKey is VQWNQYQLCMVPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClN2.C5H12O2.Ir/c1-10-15(11-6-8-12(16)9-7-11)18-14-5-3-2-4-13(14)17-10;1-4(6)3-5(2)7;/h2-6,8-9H,1H3;4-7H,3H2,1-2H3;/q-1;;.
What are the key properties of 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol?
2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol has a molecular weight of 550.08 g/mol, XLogP of 4.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;iridium;pentane-2,4-diol is sourced from PubChem (CID 58330980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).