C22H38BN6O9PS — CID 58331213
[2-[4-[2-[3-(2,5-dioxo-3-phosphanyliminoboranylsulfanylpyrrolidin-1-yl)propanoylamino]ethylamino]-4-oxobutoxy]-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate (PubChem CID 58331213) has the molecular formula C22H38BN6O9PS and a molecular weight of 604.43 g/mol. Its IUPAC name is [2-[4-[2-[3-(2,5-dioxo-3-phosphanyliminoboranylsulfanylpyrrolidin-1-yl)propanoylamino]ethylamino]-4-oxobutoxy]-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate.
| Compound Name | [2-[4-[2-[3-(2,5-dioxo-3-phosphanyliminoboranylsulfanylpyrrolidin-1-yl)propanoylamino]ethylamino]-4-oxobutoxy]-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 58331213 |
| Molecular Formula | C22H38BN6O9PS |
| Molecular Weight | 604.43 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | [2-[4-[2-[3-(2,5-dioxo-3-phosphanyliminoboranylsulfanylpyrrolidin-1-yl)propanoylamino]ethylamino]-4-oxobutoxy]-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OCC(COC(=O)NCC)OCCCC(=O)NCCNC(=O)CCN1C(=O)CC(S/B=N/P)C1=O |
| InChI | InChI=1S/C22H38BN6O9PS/c1-3-24-21(34)37-13-15(14-38-22(35)25-4-2)36-11-5-6-17(30)26-8-9-27-18(31)7-10-29-19(32)12-16(20(29)33)40-23-28-39/h15-16H,3-14,39H2,1-2H3,(H,24,34)(H,25,35)(H,26,30)(H,27,31) |
| InChIKey | SYFAKQIIZCTHFP-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 193.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.43 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|